About 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine
3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine (PubChem CID 71448706) has the molecular formula C18H21N3O2
and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine |
| PubChem CID | 71448706 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine |
| SMILES | CCCCc1[nH]nc2ccnc(-c3ccc(OC)c(OC)c3)c12 |
| InChI | InChI=1S/C18H21N3O2/c1-4-5-6-13-17-14(21-20-13)9-10-19-18(17)12-7-8-15(22-2)16(11-12)23-3/h7-11H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | GRLBWGNRNCEPKP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine?
The IUPAC name of 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine (CID 71448706) is 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine?
The canonical SMILES for 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine is CCCCc1[nH]nc2ccnc(-c3ccc(OC)c(OC)c3)c12.
What is the InChIKey of 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine?
The InChIKey is GRLBWGNRNCEPKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2/c1-4-5-6-13-17-14(21-20-13)9-10-19-18(17)12-7-8-15(22-2)16(11-12)23-3/h7-11H,4-6H2,1-3H3,(H,20,21).
What are the key properties of 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine?
3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine has a molecular weight of 311.39 g/mol, XLogP of 3.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-(3,4-dimethoxyphenyl)-2H-pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 71448706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).