C21H24O3 — CID 71448979
1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-7a-methylnaphtho[2,3-b]oxirene-2,7-dione (PubChem CID 71448979) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-7a-methylnaphtho[2,3-b]oxirene-2,7-dione.
| Compound Name | 1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-7a-methylnaphtho[2,3-b]oxirene-2,7-dione |
|---|---|
| PubChem CID | 71448979 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-7a-methylnaphtho[2,3-b]oxirene-2,7-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC12OC1(C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H24O3/c1-14(2)8-7-9-15(3)12-13-21-19(23)17-11-6-5-10-16(17)18(22)20(21,4)24-21/h5-6,8,10-12H,7,9,13H2,1-4H3/b15-12+ |
| InChIKey | ZEACJJRPAPKYKW-NTCAYCPXSA-N |
| XLogP | 4.68 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|