C15H19NaO7S — CID 71449042
sodium 2-phenyl-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]acetate (PubChem CID 71449042) has the molecular formula C15H19NaO7S and a molecular weight of 366.37 g/mol. Its IUPAC name is sodium 2-phenyl-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]acetate.
| Compound Name | sodium 2-phenyl-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 71449042 |
| Molecular Formula | C15H19NaO7S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | sodium 2-phenyl-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]acetate |
| SMILES | CO[C@@H]1O[C@@H](CSC(C(=O)[O-])c2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C15H20O7S.Na/c1-21-15-12(18)11(17)10(16)9(22-15)7-23-13(14(19)20)8-5-3-2-4-6-8;/h2-6,9-13,15-18H,7H2,1H3,(H,19,20);/q;+1/p-1/t9-,10+,11-,12-,13?,15+;/m0./s1 |
| InChIKey | GOLLQZNICLKXGE-PAOMGDBKSA-M |
| XLogP | -4.33 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |