C11H19NaO7S — CID 71449090
sodium 2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate (PubChem CID 71449090) has the molecular formula C11H19NaO7S and a molecular weight of 318.32 g/mol. Its IUPAC name is sodium 2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate.
| Compound Name | sodium 2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 71449090 |
| Molecular Formula | C11H19NaO7S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | sodium 2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate |
| SMILES | CCC(SC[C@@H]1O[C@@H](OC)[C@@H](O)[C@@H](O)[C@H]1O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H20O7S.Na/c1-3-6(10(15)16)19-4-5-7(12)8(13)9(14)11(17-2)18-5;/h5-9,11-14H,3-4H2,1-2H3,(H,15,16);/q;+1/p-1/t5-,6?,7-,8-,9-,11+;/m0./s1 |
| InChIKey | VDHGLONETGZBRG-WERAIWOBSA-M |
| XLogP | -5.29 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |