About 2-ethyl-4-phenyltriazole
2-ethyl-4-phenyltriazole (PubChem CID 71449346) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-ethyl-4-phenyltriazole.
Molecular Properties
| Compound Name | 2-ethyl-4-phenyltriazole |
| PubChem CID | 71449346 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-ethyl-4-phenyltriazole |
| SMILES | CCn1ncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H11N3/c1-2-13-11-8-10(12-13)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | ZMZLGHNSVYICQS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4-phenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-phenyltriazole?
The IUPAC name of 2-ethyl-4-phenyltriazole (CID 71449346) is 2-ethyl-4-phenyltriazole.
What is the SMILES notation for 2-ethyl-4-phenyltriazole?
The canonical SMILES for 2-ethyl-4-phenyltriazole is CCn1ncc(-c2ccccc2)n1.
What is the InChIKey of 2-ethyl-4-phenyltriazole?
The InChIKey is ZMZLGHNSVYICQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-2-13-11-8-10(12-13)9-6-4-3-5-7-9/h3-8H,2H2,1H3.
What are the key properties of 2-ethyl-4-phenyltriazole?
2-ethyl-4-phenyltriazole has a molecular weight of 173.22 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-phenyltriazole is sourced from PubChem (CID 71449346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).