C28H28N6S — CID 71449355
4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(4-phenyltriazol-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine (PubChem CID 71449355) has the molecular formula C28H28N6S and a molecular weight of 480.64 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(4-phenyltriazol-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(4-phenyltriazol-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 71449355 |
| Molecular Formula | C28H28N6S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-N,4-N-diethyl-2-methyl-1-N-[4-[4-(4-phenyltriazol-1-yl)phenyl]-1,3-thiazol-2-yl]benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(-c3ccc(-n4cc(-c5ccccc5)nn4)cc3)cs2)c(C)c1 |
| InChI | InChI=1S/C28H28N6S/c1-4-33(5-2)24-15-16-25(20(3)17-24)29-28-30-27(19-35-28)22-11-13-23(14-12-22)34-18-26(31-32-34)21-9-7-6-8-10-21/h6-19H,4-5H2,1-3H3,(H,29,30) |
| InChIKey | OQWRXMKPDLRVEQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|