C25H19F3N2O3 — CID 71449487
2-[(E)-3-(2,4-difluorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 71449487) has the molecular formula C25H19F3N2O3 and a molecular weight of 452.43 g/mol. Its IUPAC name is 2-[(E)-3-(2,4-difluorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | 2-[(E)-3-(2,4-difluorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 71449487 |
| Molecular Formula | C25H19F3N2O3 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[(E)-3-(2,4-difluorophenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CN(C(=O)/C(=C/c1ccc(F)cc1F)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C25H19F3N2O3/c26-20-6-3-16(4-7-20)22(12-17-5-8-21(27)13-23(17)28)25(32)30-10-9-15-1-2-18(24(31)29-33)11-19(15)14-30/h1-8,11-13,33H,9-10,14H2,(H,29,31)/b22-12+ |
| InChIKey | LDQTUDSCVFAMOA-WSDLNYQXSA-N |
| XLogP | 4.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|