C13H14ClNO — CID 71449647
3-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole (PubChem CID 71449647) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole.
| Compound Name | 3-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 71449647 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-(2-chlorophenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
| SMILES | Clc1ccccc1C1=NOC2CCCCC12 |
| InChI | InChI=1S/C13H14ClNO/c14-11-7-3-1-5-9(11)13-10-6-2-4-8-12(10)16-15-13/h1,3,5,7,10,12H,2,4,6,8H2 |
| InChIKey | JEXSORRCJOMKOT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |