C28H28Cl2N2O — CID 71449652
(E,2R,3S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine (PubChem CID 71449652) has the molecular formula C28H28Cl2N2O and a molecular weight of 479.45 g/mol. Its IUPAC name is (E,2R,3S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine.
| Compound Name | (E,2R,3S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
|---|---|
| PubChem CID | 71449652 |
| Molecular Formula | C28H28Cl2N2O |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (E,2R,3S,6S)-2,6-bis(4-chlorophenyl)-3-methyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
| SMILES | C=CCN1[C@H](c2ccc(Cl)cc2)C/C(=N\OCc2ccccc2)[C@@H](C)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H28Cl2N2O/c1-3-17-32-27(22-9-13-24(29)14-10-22)18-26(31-33-19-21-7-5-4-6-8-21)20(2)28(32)23-11-15-25(30)16-12-23/h3-16,20,27-28H,1,17-19H2,2H3/b31-26+/t20-,27+,28-/m1/s1 |
| InChIKey | HYHBRDLOXQSGFQ-GMTDJDTASA-N |
| XLogP | 7.88 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|