About N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine
N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine (PubChem CID 71449820) has the molecular formula C21H27NO2
and a molecular weight of 325.45 g/mol. Its IUPAC name is N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine.
Molecular Properties
| Compound Name | N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine |
| PubChem CID | 71449820 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine |
| SMILES | CC[C@]1(c2ccccc2)OCC[C@H](CCNCc2ccccc2)O1 |
| InChI | InChI=1S/C21H27NO2/c1-2-21(19-11-7-4-8-12-19)23-16-14-20(24-21)13-15-22-17-18-9-5-3-6-10-18/h3-12,20,22H,2,13-17H2,1H3/t20-,21-/m0/s1 |
| InChIKey | HSDJKXKQVVQRKG-SFTDATJTSA-N |
| XLogP | 4.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine?
The IUPAC name of N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine (CID 71449820) is N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine.
What is the SMILES notation for N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine?
The canonical SMILES for N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine is CC[C@]1(c2ccccc2)OCC[C@H](CCNCc2ccccc2)O1.
What is the InChIKey of N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine?
The InChIKey is HSDJKXKQVVQRKG-SFTDATJTSA-N. The full InChI is InChI=1S/C21H27NO2/c1-2-21(19-11-7-4-8-12-19)23-16-14-20(24-21)13-15-22-17-18-9-5-3-6-10-18/h3-12,20,22H,2,13-17H2,1H3/t20-,21-/m0/s1.
What are the key properties of N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine?
N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine has a molecular weight of 325.45 g/mol, XLogP of 4.23, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(2S,4S)-2-ethyl-2-phenyl-1,3-dioxan-4-yl]ethanamine is sourced from PubChem (CID 71449820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).