C16H25NO6 — CID 71449836
(2R,3R,4S)-3-acetamido-2-pentan-3-yloxy-4-prop-2-enoxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 71449836) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-2-pentan-3-yloxy-4-prop-2-enoxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-2-pentan-3-yloxy-4-prop-2-enoxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 71449836 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-2-pentan-3-yloxy-4-prop-2-enoxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C=CCO[C@H]1C=C(C(=O)O)O[C@@H](OC(CC)CC)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C16H25NO6/c1-5-8-21-12-9-13(15(19)20)23-16(14(12)17-10(4)18)22-11(6-2)7-3/h5,9,11-12,14,16H,1,6-8H2,2-4H3,(H,17,18)(H,19,20)/t12-,14+,16+/m0/s1 |
| InChIKey | SOAGLUOAFAAPOO-JGGQBBKZSA-N |
| XLogP | 1.59 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|