C23H27NO4 — CID 71449844
(5aS,7S)-7-[1-[(2-hydroxyphenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one (PubChem CID 71449844) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (5aS,7S)-7-[1-[(2-hydroxyphenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one.
| Compound Name | (5aS,7S)-7-[1-[(2-hydroxyphenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 71449844 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (5aS,7S)-7-[1-[(2-hydroxyphenyl)methylamino]propan-2-yl]-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
| SMILES | Cc1cc2c(c(=O)o1)C=C1CC[C@H](C(C)CNCc3ccccc3O)C[C@@H]1O2 |
| InChI | InChI=1S/C23H27NO4/c1-14(12-24-13-18-5-3-4-6-20(18)25)16-7-8-17-10-19-22(28-21(17)11-16)9-15(2)27-23(19)26/h3-6,9-10,14,16,21,24-25H,7-8,11-13H2,1-2H3/t14?,16-,21-/m0/s1 |
| InChIKey | HFHNVSAKEJJTBA-SVPPLLGISA-N |
| XLogP | 4.02 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|