C19H17N3O3 — CID 71449916
4-[[3-(4-carbamoylphenyl)phenyl]methyl]-5-methyl-1H-pyrazole-3-carboxylic acid (PubChem CID 71449916) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[[3-(4-carbamoylphenyl)phenyl]methyl]-5-methyl-1H-pyrazole-3-carboxylic acid.
| Compound Name | 4-[[3-(4-carbamoylphenyl)phenyl]methyl]-5-methyl-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 71449916 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-[[3-(4-carbamoylphenyl)phenyl]methyl]-5-methyl-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1[nH]nc(C(=O)O)c1Cc1cccc(-c2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C19H17N3O3/c1-11-16(17(19(24)25)22-21-11)10-12-3-2-4-15(9-12)13-5-7-14(8-6-13)18(20)23/h2-9H,10H2,1H3,(H2,20,23)(H,21,22)(H,24,25) |
| InChIKey | AYFOHGQYRAAKBZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |