About 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride
2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride (PubChem CID 71449998) has the molecular formula C12H17ClN2O2
and a molecular weight of 256.73 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride |
| PubChem CID | 71449998 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride |
| SMILES | CCN(C)C(=O)Oc1cccc2c1CCN2.Cl |
| InChI | InChI=1S/C12H16N2O2.ClH/c1-3-14(2)12(15)16-11-6-4-5-10-9(11)7-8-13-10;/h4-6,13H,3,7-8H2,1-2H3;1H |
| InChIKey | OXHZNBHPPOMDRM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride?
The IUPAC name of 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride (CID 71449998) is 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride.
What is the SMILES notation for 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride?
The canonical SMILES for 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride is CCN(C)C(=O)Oc1cccc2c1CCN2.Cl.
What is the InChIKey of 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride?
The InChIKey is OXHZNBHPPOMDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2.ClH/c1-3-14(2)12(15)16-11-6-4-5-10-9(11)7-8-13-10;/h4-6,13H,3,7-8H2,1-2H3;1H.
What are the key properties of 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride?
2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride has a molecular weight of 256.73 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indol-4-yl N-ethyl-N-methylcarbamate;hydrochloride is sourced from PubChem (CID 71449998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).