About 1,2-dibromoethylbenzene
1,2-dibromoethylbenzene (PubChem CID 7145) has the molecular formula C8H8Br2
and a molecular weight of 263.96 g/mol. Its IUPAC name is 1,2-dibromoethylbenzene.
Molecular Properties
| Compound Name | 1,2-dibromoethylbenzene |
| PubChem CID | 7145 |
| Molecular Formula | C8H8Br2 |
| Molecular Weight | 263.96 g/mol |
| Exact Mass | 261.90 |
| IUPAC Name | 1,2-dibromoethylbenzene |
| SMILES | BrCC(Br)c1ccccc1 |
| InChI | InChI=1S/C8H8Br2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | SHKKTLSDGJRCTR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibromoethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromoethylbenzene?
The IUPAC name of 1,2-dibromoethylbenzene (CID 7145) is 1,2-dibromoethylbenzene.
What is the SMILES notation for 1,2-dibromoethylbenzene?
The canonical SMILES for 1,2-dibromoethylbenzene is BrCC(Br)c1ccccc1.
What is the InChIKey of 1,2-dibromoethylbenzene?
The InChIKey is SHKKTLSDGJRCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of 1,2-dibromoethylbenzene?
1,2-dibromoethylbenzene has a molecular weight of 263.96 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromoethylbenzene is sourced from PubChem (CID 7145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).