About 2-hexoxyethyl 2-hydroxybutanoate
2-hexoxyethyl 2-hydroxybutanoate (PubChem CID 71450081) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-hexoxyethyl 2-hydroxybutanoate.
Molecular Properties
| Compound Name | 2-hexoxyethyl 2-hydroxybutanoate |
| PubChem CID | 71450081 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-hexoxyethyl 2-hydroxybutanoate |
| SMILES | CCCCCCOCCOC(=O)C(O)CC |
| InChI | InChI=1S/C12H24O4/c1-3-5-6-7-8-15-9-10-16-12(14)11(13)4-2/h11,13H,3-10H2,1-2H3 |
| InChIKey | UAWHEBJRSITOJF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexoxyethyl 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexoxyethyl 2-hydroxybutanoate?
The IUPAC name of 2-hexoxyethyl 2-hydroxybutanoate (CID 71450081) is 2-hexoxyethyl 2-hydroxybutanoate.
What is the SMILES notation for 2-hexoxyethyl 2-hydroxybutanoate?
The canonical SMILES for 2-hexoxyethyl 2-hydroxybutanoate is CCCCCCOCCOC(=O)C(O)CC.
What is the InChIKey of 2-hexoxyethyl 2-hydroxybutanoate?
The InChIKey is UAWHEBJRSITOJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4/c1-3-5-6-7-8-15-9-10-16-12(14)11(13)4-2/h11,13H,3-10H2,1-2H3.
What are the key properties of 2-hexoxyethyl 2-hydroxybutanoate?
2-hexoxyethyl 2-hydroxybutanoate has a molecular weight of 232.32 g/mol, XLogP of 1.90, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexoxyethyl 2-hydroxybutanoate is sourced from PubChem (CID 71450081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).