About 5-phenylpentyl 2-hydroxybutanoate
5-phenylpentyl 2-hydroxybutanoate (PubChem CID 71450083) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-phenylpentyl 2-hydroxybutanoate.
Molecular Properties
| Compound Name | 5-phenylpentyl 2-hydroxybutanoate |
| PubChem CID | 71450083 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5-phenylpentyl 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)OCCCCCc1ccccc1 |
| InChI | InChI=1S/C15H22O3/c1-2-14(16)15(17)18-12-8-4-7-11-13-9-5-3-6-10-13/h3,5-6,9-10,14,16H,2,4,7-8,11-12H2,1H3 |
| InChIKey | NXJJGEPCDHFPSF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylpentyl 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpentyl 2-hydroxybutanoate?
The IUPAC name of 5-phenylpentyl 2-hydroxybutanoate (CID 71450083) is 5-phenylpentyl 2-hydroxybutanoate.
What is the SMILES notation for 5-phenylpentyl 2-hydroxybutanoate?
The canonical SMILES for 5-phenylpentyl 2-hydroxybutanoate is CCC(O)C(=O)OCCCCCc1ccccc1.
What is the InChIKey of 5-phenylpentyl 2-hydroxybutanoate?
The InChIKey is NXJJGEPCDHFPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-2-14(16)15(17)18-12-8-4-7-11-13-9-5-3-6-10-13/h3,5-6,9-10,14,16H,2,4,7-8,11-12H2,1H3.
What are the key properties of 5-phenylpentyl 2-hydroxybutanoate?
5-phenylpentyl 2-hydroxybutanoate has a molecular weight of 250.34 g/mol, XLogP of 2.71, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpentyl 2-hydroxybutanoate is sourced from PubChem (CID 71450083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).