About 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid
3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid (PubChem CID 714501) has the molecular formula C11H8ClNO4
and a molecular weight of 253.64 g/mol. Its IUPAC name is 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid |
| PubChem CID | 714501 |
| Molecular Formula | C11H8ClNO4 |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid |
| SMILES | O=C(O)CCc1nc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C11H8ClNO4/c12-6-1-3-9-8(5-6)13-7(11(16)17-9)2-4-10(14)15/h1,3,5H,2,4H2,(H,14,15) |
| InChIKey | WCRDDKVERFEJQC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'coumarin_C(1)', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid?
The IUPAC name of 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid (CID 714501) is 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid.
What is the SMILES notation for 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid?
The canonical SMILES for 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid is O=C(O)CCc1nc2cc(Cl)ccc2oc1=O.
What is the InChIKey of 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid?
The InChIKey is WCRDDKVERFEJQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO4/c12-6-1-3-9-8(5-6)13-7(11(16)17-9)2-4-10(14)15/h1,3,5H,2,4H2,(H,14,15).
What are the key properties of 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid?
3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid has a molecular weight of 253.64 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-chloro-2-oxo-1,4-benzoxazin-3-yl)propanoic acid is sourced from PubChem (CID 714501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).