C33H35N5O4S — CID 71450294
(E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-[2-(methylamino)-1,3-thiazol-4-yl]indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71450294) has the molecular formula C33H35N5O4S and a molecular weight of 597.74 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-[2-(methylamino)-1,3-thiazol-4-yl]indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-[2-(methylamino)-1,3-thiazol-4-yl]indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71450294 |
| Molecular Formula | C33H35N5O4S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-[2-(methylamino)-1,3-thiazol-4-yl]indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CNc1nc(-c2c(C3CCCC3)c3ccc(C(=O)NC4(C(=O)Nc5ccc(/C=C/C(=O)O)cc5)CCC4)cc3n2C)cs1 |
| InChI | InChI=1S/C33H35N5O4S/c1-34-32-36-25(19-43-32)29-28(21-6-3-4-7-21)24-14-11-22(18-26(24)38(29)2)30(41)37-33(16-5-17-33)31(42)35-23-12-8-20(9-13-23)10-15-27(39)40/h8-15,18-19,21H,3-7,16-17H2,1-2H3,(H,34,36)(H,35,42)(H,37,41)(H,39,40)/b15-10+ |
| InChIKey | GWGJZZOHFQSTTK-XNTDXEJSSA-N |
| XLogP | 6.39 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|