C31H32N4O5 — CID 71450301
(E)-3-[4-[[2-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71450301) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is (E)-3-[4-[[2-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71450301 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | (E)-3-[4-[[2-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cn1c(-c2cocn2)c(C2CCCC2)c2ccc(C(=O)NC(C)(C)C(=O)Nc3ccc(/C=C/C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C31H32N4O5/c1-31(2,30(39)33-22-12-8-19(9-13-22)10-15-26(36)37)34-29(38)21-11-14-23-25(16-21)35(3)28(24-17-40-18-32-24)27(23)20-6-4-5-7-20/h8-18,20H,4-7H2,1-3H3,(H,33,39)(H,34,38)(H,36,37)/b15-10+ |
| InChIKey | FTMRAIANUMCKGY-XNTDXEJSSA-N |
| XLogP | 5.74 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|