C34H37N5O5 — CID 71450304
(E)-3-[4-[[4-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71450304) has the molecular formula C34H37N5O5 and a molecular weight of 595.70 g/mol. Its IUPAC name is (E)-3-[4-[[4-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71450304 |
| Molecular Formula | C34H37N5O5 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | (E)-3-[4-[[4-[[3-cyclopentyl-1-methyl-2-(1,3-oxazol-4-yl)indole-6-carbonyl]amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN1CCC(NC(=O)c2ccc3c(C4CCCC4)c(-c4cocn4)n(C)c3c2)(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C34H37N5O5/c1-38-17-15-34(16-18-38,33(43)36-25-11-7-22(8-12-25)9-14-29(40)41)37-32(42)24-10-13-26-28(19-24)39(2)31(27-20-44-21-35-27)30(26)23-5-3-4-6-23/h7-14,19-21,23H,3-6,15-18H2,1-2H3,(H,36,43)(H,37,42)(H,40,41)/b14-9+ |
| InChIKey | DQWMVXDLEXWYRO-NTEUORMPSA-N |
| XLogP | 5.42 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|