C26H45N3O5Si — CID 71450320
(2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-dihydroxysilyl]-3-methylbutyl]-3-methyl-2-[(2-phenylacetyl)amino]pentanamide (PubChem CID 71450320) has the molecular formula C26H45N3O5Si and a molecular weight of 507.75 g/mol. Its IUPAC name is (2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-dihydroxysilyl]-3-methylbutyl]-3-methyl-2-[(2-phenylacetyl)amino]pentanamide.
| Compound Name | (2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-dihydroxysilyl]-3-methylbutyl]-3-methyl-2-[(2-phenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 71450320 |
| Molecular Formula | C26H45N3O5Si |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-dihydroxysilyl]-3-methylbutyl]-3-methyl-2-[(2-phenylacetyl)amino]pentanamide |
| SMILES | CCCCNC(=O)CC[Si](O)(O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)Cc1ccccc1)[C@@H](C)CC |
| InChI | InChI=1S/C26H45N3O5Si/c1-6-8-15-27-22(30)14-16-35(33,34)24(17-19(3)4)29-26(32)25(20(5)7-2)28-23(31)18-21-12-10-9-11-13-21/h9-13,19-20,24-25,33-34H,6-8,14-18H2,1-5H3,(H,27,30)(H,28,31)(H,29,32)/t20-,24+,25-/m0/s1 |
| InChIKey | SQTNLCMAIDJMET-AMDXRBSFSA-N |
| XLogP | 2.56 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|