About methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate
methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate (PubChem CID 71450371) has the molecular formula C19H23NO9S
and a molecular weight of 441.46 g/mol. Its IUPAC name is methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate.
Molecular Properties
| Compound Name | methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate |
| PubChem CID | 71450371 |
| Molecular Formula | C19H23NO9S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate |
| SMILES | COC(=O)[C@@H](N)CSC(=O)C(Cc1ccc(OC(C)=O)c(OC(C)=O)c1)OC(C)=O |
| InChI | InChI=1S/C19H23NO9S/c1-10(21)27-15-6-5-13(7-16(15)28-11(2)22)8-17(29-12(3)23)19(25)30-9-14(20)18(24)26-4/h5-7,14,17H,8-9,20H2,1-4H3/t14-,17?/m0/s1 |
| InChIKey | IGKBQKYPQQFGFS-MBIQTGHCSA-N |
| XLogP | 0.77 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate?
The IUPAC name of methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate (CID 71450371) is methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate.
What is the SMILES notation for methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate?
The canonical SMILES for methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate is COC(=O)[C@@H](N)CSC(=O)C(Cc1ccc(OC(C)=O)c(OC(C)=O)c1)OC(C)=O.
What is the InChIKey of methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate?
The InChIKey is IGKBQKYPQQFGFS-MBIQTGHCSA-N. The full InChI is InChI=1S/C19H23NO9S/c1-10(21)27-15-6-5-13(7-16(15)28-11(2)22)8-17(29-12(3)23)19(25)30-9-14(20)18(24)26-4/h5-7,14,17H,8-9,20H2,1-4H3/t14-,17?/m0/s1.
What are the key properties of methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate?
methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate has a molecular weight of 441.46 g/mol, XLogP of 0.77, 9 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3-[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]sulfanyl-2-aminopropanoate is sourced from PubChem (CID 71450371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).