C20H29ClIN — CID 71450530
2-(4-chlorophenyl)ethyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide (PubChem CID 71450530) has the molecular formula C20H29ClIN and a molecular weight of 445.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)ethyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide.
| Compound Name | 2-(4-chlorophenyl)ethyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 71450530 |
| Molecular Formula | C20H29ClIN |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-(4-chlorophenyl)ethyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide |
| SMILES | CC1(C)[C@H]2CC=C(C[N+](C)(C)CCc3ccc(Cl)cc3)[C@@H]1C2.[I-] |
| InChI | InChI=1S/C20H29ClN.HI/c1-20(2)17-8-7-16(19(20)13-17)14-22(3,4)12-11-15-5-9-18(21)10-6-15;/h5-7,9-10,17,19H,8,11-14H2,1-4H3;1H/q+1;/p-1/t17-,19-;/m0./s1 |
| InChIKey | OQPMHLBMUHYMQS-QQTWVUFVSA-M |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|