About N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide
N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide (PubChem CID 71450554) has the molecular formula C24H23Cl2NO3
and a molecular weight of 444.36 g/mol. Its IUPAC name is N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide.
Molecular Properties
| Compound Name | N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide |
| PubChem CID | 71450554 |
| Molecular Formula | C24H23Cl2NO3 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide |
| SMILES | CCOc1ccc(-c2cc(NC(=O)C(Cl)Cl)cc(-c3ccc(OCC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H23Cl2NO3/c1-3-29-21-9-5-16(6-10-21)18-13-19(15-20(14-18)27-24(28)23(25)26)17-7-11-22(12-8-17)30-4-2/h5-15,23H,3-4H2,1-2H3,(H,27,28) |
| InChIKey | WZZKMCGDUAHHPF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide?
The IUPAC name of N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide (CID 71450554) is N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide.
What is the SMILES notation for N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide?
The canonical SMILES for N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide is CCOc1ccc(-c2cc(NC(=O)C(Cl)Cl)cc(-c3ccc(OCC)cc3)c2)cc1.
What is the InChIKey of N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide?
The InChIKey is WZZKMCGDUAHHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23Cl2NO3/c1-3-29-21-9-5-16(6-10-21)18-13-19(15-20(14-18)27-24(28)23(25)26)17-7-11-22(12-8-17)30-4-2/h5-15,23H,3-4H2,1-2H3,(H,27,28).
What are the key properties of N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide?
N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide has a molecular weight of 444.36 g/mol, XLogP of 6.56, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(4-ethoxyphenyl)phenyl]-2,2-dichloroacetamide is sourced from PubChem (CID 71450554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).