C16H24O4 — CID 71450600
(3aS,6R,6aR,9R,9aS,9bS)-9-hydroxy-6-methoxy-6,9-dimethyl-3-methylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 71450600) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (3aS,6R,6aR,9R,9aS,9bS)-9-hydroxy-6-methoxy-6,9-dimethyl-3-methylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3aS,6R,6aR,9R,9aS,9bS)-9-hydroxy-6-methoxy-6,9-dimethyl-3-methylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 71450600 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (3aS,6R,6aR,9R,9aS,9bS)-9-hydroxy-6-methoxy-6,9-dimethyl-3-methylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2[C@@H]3[C@@H](CC[C@@]3(C)O)[C@](C)(OC)CC[C@@H]12 |
| InChI | InChI=1S/C16H24O4/c1-9-10-5-8-16(3,19-4)11-6-7-15(2,18)12(11)13(10)20-14(9)17/h10-13,18H,1,5-8H2,2-4H3/t10-,11+,12-,13-,15+,16+/m0/s1 |
| InChIKey | NADODSHYBZXLJH-LQTRTAQESA-N |
| XLogP | 2.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|