C23H23F3N4O4S — CID 71450605
(3R)-3-amino-N-[1,1-dioxo-4-(5-phenyl-1,3,4-oxadiazol-2-yl)thian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide (PubChem CID 71450605) has the molecular formula C23H23F3N4O4S and a molecular weight of 508.52 g/mol. Its IUPAC name is (3R)-3-amino-N-[1,1-dioxo-4-(5-phenyl-1,3,4-oxadiazol-2-yl)thian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | (3R)-3-amino-N-[1,1-dioxo-4-(5-phenyl-1,3,4-oxadiazol-2-yl)thian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 71450605 |
| Molecular Formula | C23H23F3N4O4S |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | (3R)-3-amino-N-[1,1-dioxo-4-(5-phenyl-1,3,4-oxadiazol-2-yl)thian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
| SMILES | N[C@@H](CC(=O)NC1(c2nnc(-c3ccccc3)o2)CCS(=O)(=O)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H23F3N4O4S/c24-17-13-19(26)18(25)11-15(17)10-16(27)12-20(31)28-23(6-8-35(32,33)9-7-23)22-30-29-21(34-22)14-4-2-1-3-5-14/h1-5,11,13,16H,6-10,12,27H2,(H,28,31)/t16-/m1/s1 |
| InChIKey | DTKUIRHPKZVISZ-MRXNPFEDSA-N |
| XLogP | 2.63 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|