C12H15N5O6 — CID 71450622
1-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione (PubChem CID 71450622) has the molecular formula C12H15N5O6 and a molecular weight of 325.28 g/mol. Its IUPAC name is 1-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71450622 |
| Molecular Formula | C12H15N5O6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)nn2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N5O6/c18-5-7-9(20)10(21)11(23-7)17-4-6(14-15-17)3-16-2-1-8(19)13-12(16)22/h1-2,4,7,9-11,18,20-21H,3,5H2,(H,13,19,22)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | HUSMKQOXUIOPRU-QCNRFFRDSA-N |
| XLogP | -3.21 |
| TPSA | 155.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |