C22H25N3OS — CID 7145064
(2S)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2-methylquinazolin-4-yl)sulfanylpropanamide (PubChem CID 7145064) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is (2S)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2-methylquinazolin-4-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2-methylquinazolin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7145064 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (2S)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2-methylquinazolin-4-yl)sulfanylpropanamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)[C@H](C)Sc1nc(C)nc2ccccc12 |
| InChI | InChI=1S/C22H25N3OS/c1-5-14(2)17-10-6-8-12-19(17)25-21(26)15(3)27-22-18-11-7-9-13-20(18)23-16(4)24-22/h6-15H,5H2,1-4H3,(H,25,26)/t14-,15-/m0/s1 |
| InChIKey | DIERCFBBFREBNV-GJZGRUSLSA-N |
| XLogP | 5.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |