C36H43N4O5+ — CID 71450662
3-[[(2S)-3-(4-hydroxyphenyl)-2-[(4-propan-2-yloxycarbonylphenyl)carbamoylamino]propanoyl]amino]propyl-dimethyl-(naphthalen-2-ylmethyl)azanium (PubChem CID 71450662) has the molecular formula C36H43N4O5+ and a molecular weight of 611.76 g/mol. Its IUPAC name is 3-[[(2S)-3-(4-hydroxyphenyl)-2-[(4-propan-2-yloxycarbonylphenyl)carbamoylamino]propanoyl]amino]propyl-dimethyl-(naphthalen-2-ylmethyl)azanium.
| Compound Name | 3-[[(2S)-3-(4-hydroxyphenyl)-2-[(4-propan-2-yloxycarbonylphenyl)carbamoylamino]propanoyl]amino]propyl-dimethyl-(naphthalen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 71450662 |
| Molecular Formula | C36H43N4O5+ |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | 3-[[(2S)-3-(4-hydroxyphenyl)-2-[(4-propan-2-yloxycarbonylphenyl)carbamoylamino]propanoyl]amino]propyl-dimethyl-(naphthalen-2-ylmethyl)azanium |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)NCCC[N+](C)(C)Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C36H42N4O5/c1-25(2)45-35(43)29-14-16-31(17-15-29)38-36(44)39-33(23-26-11-18-32(41)19-12-26)34(42)37-20-7-21-40(3,4)24-27-10-13-28-8-5-6-9-30(28)22-27/h5-6,8-19,22,25,33H,7,20-21,23-24H2,1-4H3,(H3-,37,38,39,41,42,43,44)/p+1/t33-/m0/s1 |
| InChIKey | ZRESSCFPNIPPGT-XIFFEERXSA-O |
| XLogP | 5.63 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|