C22H24F2N2O5 — CID 71450784
ethyl 2-[(3,5-difluorophenyl)methyl-[2-(hydroxymethyl)-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]amino]-2-oxoacetate (PubChem CID 71450784) has the molecular formula C22H24F2N2O5 and a molecular weight of 434.44 g/mol. Its IUPAC name is ethyl 2-[(3,5-difluorophenyl)methyl-[2-(hydroxymethyl)-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(3,5-difluorophenyl)methyl-[2-(hydroxymethyl)-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 71450784 |
| Molecular Formula | C22H24F2N2O5 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | ethyl 2-[(3,5-difluorophenyl)methyl-[2-(hydroxymethyl)-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(Cc1cc(F)cc(F)c1)c1ccc2c(c1)OC(C)(CO)CN2C |
| InChI | InChI=1S/C22H24F2N2O5/c1-4-30-21(29)20(28)26(11-14-7-15(23)9-16(24)8-14)17-5-6-18-19(10-17)31-22(2,13-27)12-25(18)3/h5-10,27H,4,11-13H2,1-3H3 |
| InChIKey | PHBZPHZFKWGSFE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|