About (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one
(6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one (PubChem CID 71450817) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one.
Molecular Properties
| Compound Name | (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one |
| PubChem CID | 71450817 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one |
| SMILES | C[C@H]1CC[C@H](C)C12CCOC2=O |
| InChI | InChI=1S/C10H16O2/c1-7-3-4-8(2)10(7)5-6-12-9(10)11/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | CQORSWAIFJDWPQ-YUMQZZPRSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one?
The IUPAC name of (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one (CID 71450817) is (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one.
What is the SMILES notation for (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one?
The canonical SMILES for (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one is C[C@H]1CC[C@H](C)C12CCOC2=O.
What is the InChIKey of (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one?
The InChIKey is CQORSWAIFJDWPQ-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H16O2/c1-7-3-4-8(2)10(7)5-6-12-9(10)11/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one?
(6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one has a molecular weight of 168.24 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,9S)-6,9-dimethyl-2-oxaspiro[4.4]nonan-1-one is sourced from PubChem (CID 71450817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).