C35H53N3O5 — CID 71450856
(2S,3S)-2-[[(2S)-2-acetamido-3-cyclohexylpropanoyl]amino]-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-naphthalen-2-ylheptan-2-yl]-3-methylpentanamide (PubChem CID 71450856) has the molecular formula C35H53N3O5 and a molecular weight of 595.83 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-acetamido-3-cyclohexylpropanoyl]amino]-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-naphthalen-2-ylheptan-2-yl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[(2S)-2-acetamido-3-cyclohexylpropanoyl]amino]-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-naphthalen-2-ylheptan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 71450856 |
| Molecular Formula | C35H53N3O5 |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.40 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-acetamido-3-cyclohexylpropanoyl]amino]-N-[(2S,3R,4S)-3,4-dihydroxy-6-methyl-1-naphthalen-2-ylheptan-2-yl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC1CCCCC1)NC(C)=O)C(=O)N[C@@H](Cc1ccc2ccccc2c1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C35H53N3O5/c1-6-23(4)32(38-34(42)30(36-24(5)39)20-25-12-8-7-9-13-25)35(43)37-29(33(41)31(40)18-22(2)3)21-26-16-17-27-14-10-11-15-28(27)19-26/h10-11,14-17,19,22-23,25,29-33,40-41H,6-9,12-13,18,20-21H2,1-5H3,(H,36,39)(H,37,43)(H,38,42)/t23-,29-,30-,31-,32-,33+/m0/s1 |
| InChIKey | LQCJJENFTPZACS-CKMCQWPASA-N |
| XLogP | 4.64 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |