C41H56N6O6 — CID 71450884
(3R,10S,13R,16S,19R,22S)-13,19-dibenzyl-10-[(2S)-butan-2-yl]-16,17,20-trimethyl-1,8,11,14,17,20-hexazatricyclo[20.4.0.03,8]hexacosane-2,9,12,15,18,21-hexone (PubChem CID 71450884) has the molecular formula C41H56N6O6 and a molecular weight of 728.94 g/mol. Its IUPAC name is (3R,10S,13R,16S,19R,22S)-13,19-dibenzyl-10-[(2S)-butan-2-yl]-16,17,20-trimethyl-1,8,11,14,17,20-hexazatricyclo[20.4.0.03,8]hexacosane-2,9,12,15,18,21-hexone.
| Compound Name | (3R,10S,13R,16S,19R,22S)-13,19-dibenzyl-10-[(2S)-butan-2-yl]-16,17,20-trimethyl-1,8,11,14,17,20-hexazatricyclo[20.4.0.03,8]hexacosane-2,9,12,15,18,21-hexone |
|---|---|
| PubChem CID | 71450884 |
| Molecular Formula | C41H56N6O6 |
| Molecular Weight | 728.94 g/mol |
| Exact Mass | 728.43 |
| IUPAC Name | (3R,10S,13R,16S,19R,22S)-13,19-dibenzyl-10-[(2S)-butan-2-yl]-16,17,20-trimethyl-1,8,11,14,17,20-hexazatricyclo[20.4.0.03,8]hexacosane-2,9,12,15,18,21-hexone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](C)N(C)C(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H]2CCCCN2C(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C41H56N6O6/c1-6-27(2)35-41(53)47-24-16-14-22-33(47)40(52)46-23-15-13-21-32(46)38(50)45(5)34(26-30-19-11-8-12-20-30)39(51)44(4)28(3)36(48)42-31(37(49)43-35)25-29-17-9-7-10-18-29/h7-12,17-20,27-28,31-35H,6,13-16,21-26H2,1-5H3,(H,42,48)(H,43,49)/t27-,28-,31+,32-,33+,34+,35-/m0/s1 |
| InChIKey | MPUGMRKHMBWWSJ-JYQBIQBTSA-N |
| XLogP | 2.94 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |