C23H34O2 — CID 71450987
cis-ethyl (1R,2S)-2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]cyclopropane-1-carboxylate (PubChem CID 71450987) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71450987 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | cis-ethyl (1R,2S)-2-methyl-2-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@]1(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H34O2/c1-7-25-21(24)20-16-23(20,6)15-8-10-17(2)12-13-19-18(3)11-9-14-22(19,4)5/h8,10,12-13,15,20H,7,9,11,14,16H2,1-6H3/b13-12+,15-8+,17-10+/t20-,23+/m0/s1 |
| InChIKey | MTGJEKMTXCEFTB-PWZHTVMVSA-N |
| XLogP | 6.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|