C23H23F3N4O3 — CID 71451077
N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carboxamide (PubChem CID 71451077) has the molecular formula C23H23F3N4O3 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carboxamide.
| Compound Name | N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71451077 |
| Molecular Formula | C23H23F3N4O3 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[2-[2-(2-methylpyrimidin-5-yl)phenyl]ethyl]-6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carboxamide |
| SMILES | Cc1ncc(-c2ccccc2CCNC(=O)c2ccc(OCCOCC(F)(F)F)nc2)cn1 |
| InChI | InChI=1S/C23H23F3N4O3/c1-16-28-13-19(14-29-16)20-5-3-2-4-17(20)8-9-27-22(31)18-6-7-21(30-12-18)33-11-10-32-15-23(24,25)26/h2-7,12-14H,8-11,15H2,1H3,(H,27,31) |
| InChIKey | CBBHGGGYBJMVTI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|