C24H21ClF5N3O2 — CID 71451229
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-ethylurea (PubChem CID 71451229) has the molecular formula C24H21ClF5N3O2 and a molecular weight of 513.89 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-ethylurea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-ethylurea |
|---|---|
| PubChem CID | 71451229 |
| Molecular Formula | C24H21ClF5N3O2 |
| Molecular Weight | 513.89 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C24H21ClF5N3O2/c1-2-31-22(34)33-23(13-15-6-4-3-5-7-15,20-9-8-17(25)14-32-20)16-10-18(26)12-19(11-16)35-24(29,30)21(27)28/h3-12,14,21H,2,13H2,1H3,(H2,31,33,34)/t23-/m0/s1 |
| InChIKey | LRYPSUCKTMZWLL-QHCPKHFHSA-N |
| XLogP | 5.92 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.89 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|