C24H26ClNO3 — CID 71451242
(2R,6S,8E)-6-[(4-chlorophenyl)methyl]-4-methyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 71451242) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is (2R,6S,8E)-6-[(4-chlorophenyl)methyl]-4-methyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
| Compound Name | (2R,6S,8E)-6-[(4-chlorophenyl)methyl]-4-methyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 71451242 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (2R,6S,8E)-6-[(4-chlorophenyl)methyl]-4-methyl-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | CN1C[C@@H](c2ccccc2)OC(=O)CC/C=C/C[C@@H](Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H26ClNO3/c1-26-17-22(19-8-4-2-5-9-19)29-23(27)11-7-3-6-10-20(24(26)28)16-18-12-14-21(25)15-13-18/h2-6,8-9,12-15,20,22H,7,10-11,16-17H2,1H3/b6-3+/t20-,22-/m0/s1 |
| InChIKey | FDSZEPJEHLNGEA-FZQIFAQWSA-N |
| XLogP | 4.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|