C21H17F3N4O — CID 71451316
2-[4-(1,8-naphthyridin-2-yl)butyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole (PubChem CID 71451316) has the molecular formula C21H17F3N4O and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-[4-(1,8-naphthyridin-2-yl)butyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-(1,8-naphthyridin-2-yl)butyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71451316 |
| Molecular Formula | C21H17F3N4O |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[4-(1,8-naphthyridin-2-yl)butyl]-5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(-c2nnc(CCCCc3ccc4cccnc4n3)o2)cc1 |
| InChI | InChI=1S/C21H17F3N4O/c22-21(23,24)16-10-7-15(8-11-16)20-28-27-18(29-20)6-2-1-5-17-12-9-14-4-3-13-25-19(14)26-17/h3-4,7-13H,1-2,5-6H2 |
| InChIKey | LDCXSUWPCFSDPG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|