C16H17F4NO — CID 71451461
3-[4-fluoro-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole (PubChem CID 71451461) has the molecular formula C16H17F4NO and a molecular weight of 315.31 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole.
| Compound Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole |
|---|---|
| PubChem CID | 71451461 |
| Molecular Formula | C16H17F4NO |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole |
| SMILES | Fc1ccc(C2=NOC3CCCCCCC23)cc1C(F)(F)F |
| InChI | InChI=1S/C16H17F4NO/c17-13-8-7-10(9-12(13)16(18,19)20)15-11-5-3-1-2-4-6-14(11)22-21-15/h7-9,11,14H,1-6H2 |
| InChIKey | PTCNDYVSDJGJEI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |