C17H17NO — CID 71451463
3-naphthalen-1-yl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole (PubChem CID 71451463) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-naphthalen-1-yl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole.
| Compound Name | 3-naphthalen-1-yl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 71451463 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-naphthalen-1-yl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
| SMILES | c1ccc2c(C3=NOC4CCCCC34)cccc2c1 |
| InChI | InChI=1S/C17H17NO/c1-2-8-13-12(6-1)7-5-10-14(13)17-15-9-3-4-11-16(15)19-18-17/h1-2,5-8,10,15-16H,3-4,9,11H2 |
| InChIKey | HBWASEHQPCVFMD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |