C29H32N2O — CID 71451465
(E,2S,6S)-3,3-dimethyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine (PubChem CID 71451465) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is (E,2S,6S)-3,3-dimethyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine.
| Compound Name | (E,2S,6S)-3,3-dimethyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
|---|---|
| PubChem CID | 71451465 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (E,2S,6S)-3,3-dimethyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
| SMILES | C=CCN1[C@@H](c2ccccc2)C(C)(C)/C(=N/OCc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H32N2O/c1-4-20-31-26(24-16-10-6-11-17-24)21-27(30-32-22-23-14-8-5-9-15-23)29(2,3)28(31)25-18-12-7-13-19-25/h4-19,26,28H,1,20-22H2,2-3H3/b30-27+/t26-,28-/m0/s1 |
| InChIKey | XVZZQVCLOLOSPF-ZHZFMGIYSA-N |
| XLogP | 6.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|