About 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine
1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine (PubChem CID 71451629) has the molecular formula C18H24Cl2N4O
and a molecular weight of 383.32 g/mol. Its IUPAC name is 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine |
| PubChem CID | 71451629 |
| Molecular Formula | C18H24Cl2N4O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine |
| SMILES | Cc1cc(OCCCN2CCN(C)CC2)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H24Cl2N4O/c1-14-12-18(21-24(14)15-4-5-16(19)17(20)13-15)25-11-3-6-23-9-7-22(2)8-10-23/h4-5,12-13H,3,6-11H2,1-2H3 |
| InChIKey | WZRGRJFCSUGMBM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine?
The IUPAC name of 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine (CID 71451629) is 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine.
What is the SMILES notation for 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine?
The canonical SMILES for 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine is Cc1cc(OCCCN2CCN(C)CC2)nn1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine?
The InChIKey is WZRGRJFCSUGMBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24Cl2N4O/c1-14-12-18(21-24(14)15-4-5-16(19)17(20)13-15)25-11-3-6-23-9-7-22(2)8-10-23/h4-5,12-13H,3,6-11H2,1-2H3.
What are the key properties of 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine?
1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine has a molecular weight of 383.32 g/mol, XLogP of 3.50, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[1-(3,4-dichlorophenyl)-5-methylpyrazol-3-yl]oxypropyl]-4-methylpiperazine is sourced from PubChem (CID 71451629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).