About 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid
3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid (PubChem CID 71451742) has the molecular formula C16H14ClNO4S
and a molecular weight of 351.81 g/mol. Its IUPAC name is 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
| PubChem CID | 71451742 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCc3ccc(Cl)cc3C2)c1 |
| InChI | InChI=1S/C16H14ClNO4S/c17-14-5-4-11-6-7-18(10-13(11)8-14)23(21,22)15-3-1-2-12(9-15)16(19)20/h1-5,8-9H,6-7,10H2,(H,19,20) |
| InChIKey | HXGFQMHALOPCDW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The IUPAC name of 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid (CID 71451742) is 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid.
What is the SMILES notation for 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The canonical SMILES for 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid is O=C(O)c1cccc(S(=O)(=O)N2CCc3ccc(Cl)cc3C2)c1.
What is the InChIKey of 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The InChIKey is HXGFQMHALOPCDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO4S/c17-14-5-4-11-6-7-18(10-13(11)8-14)23(21,22)15-3-1-2-12(9-15)16(19)20/h1-5,8-9H,6-7,10H2,(H,19,20).
What are the key properties of 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid has a molecular weight of 351.81 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid is sourced from PubChem (CID 71451742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).