C26H23ClFNO5 — CID 71451931
N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide (PubChem CID 71451931) has the molecular formula C26H23ClFNO5 and a molecular weight of 483.92 g/mol. Its IUPAC name is N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide.
| Compound Name | N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide |
|---|---|
| PubChem CID | 71451931 |
| Molecular Formula | C26H23ClFNO5 |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Cl)cc3)[C@H](c3cccc(F)c3)C[C@H](NC=O)[C@@]21O |
| InChI | InChI=1S/C26H23ClFNO5/c1-32-19-11-21(33-2)24-22(12-19)34-26(16-6-8-17(27)9-7-16)20(15-4-3-5-18(28)10-15)13-23(29-14-30)25(24,26)31/h3-12,14,20,23,31H,13H2,1-2H3,(H,29,30)/t20-,23-,25+,26-/m0/s1 |
| InChIKey | SIUHRIREEOGTCY-JWWGNVLFSA-N |
| XLogP | 4.27 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|