About 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine
5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine (PubChem CID 71451945) has the molecular formula C16H16FN3OS
and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine |
| PubChem CID | 71451945 |
| Molecular Formula | C16H16FN3OS |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc(-c2nc3ccc(OCCF)cc3s2)cn1 |
| InChI | InChI=1S/C16H16FN3OS/c1-20(2)15-6-3-11(10-18-15)16-19-13-5-4-12(21-8-7-17)9-14(13)22-16/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | FZGXDANXQSSCTP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine?
The IUPAC name of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine (CID 71451945) is 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine.
What is the SMILES notation for 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine?
The canonical SMILES for 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine is CN(C)c1ccc(-c2nc3ccc(OCCF)cc3s2)cn1.
What is the InChIKey of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine?
The InChIKey is FZGXDANXQSSCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3OS/c1-20(2)15-6-3-11(10-18-15)16-19-13-5-4-12(21-8-7-17)9-14(13)22-16/h3-6,9-10H,7-8H2,1-2H3.
What are the key properties of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine?
5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine has a molecular weight of 317.39 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N,N-dimethylpyridin-2-amine is sourced from PubChem (CID 71451945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).