About 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine
5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine (PubChem CID 71451948) has the molecular formula C18H20FN3O3
and a molecular weight of 345.37 g/mol. Its IUPAC name is 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine |
| PubChem CID | 71451948 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc(-c2nc3cc(OCCOCCF)ccc3o2)cn1 |
| InChI | InChI=1S/C18H20FN3O3/c1-22(2)17-6-3-13(12-20-17)18-21-15-11-14(4-5-16(15)25-18)24-10-9-23-8-7-19/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | WRWIQAIXUYCZDM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine?
The IUPAC name of 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine (CID 71451948) is 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine.
What is the SMILES notation for 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine?
The canonical SMILES for 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine is CN(C)c1ccc(-c2nc3cc(OCCOCCF)ccc3o2)cn1.
What is the InChIKey of 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine?
The InChIKey is WRWIQAIXUYCZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN3O3/c1-22(2)17-6-3-13(12-20-17)18-21-15-11-14(4-5-16(15)25-18)24-10-9-23-8-7-19/h3-6,11-12H,7-10H2,1-2H3.
What are the key properties of 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine?
5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine has a molecular weight of 345.37 g/mol, XLogP of 3.32, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N,N-dimethylpyridin-2-amine is sourced from PubChem (CID 71451948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).