About (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone
(4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone (PubChem CID 71452075) has the molecular formula C23H21N3O2
and a molecular weight of 371.44 g/mol. Its IUPAC name is (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone.
Molecular Properties
| Compound Name | (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone |
| PubChem CID | 71452075 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone |
| SMILES | O=C(c1cnccc1Oc1ccccc1)N1CCN(C2CC2)c2ccccc21 |
| InChI | InChI=1S/C23H21N3O2/c27-23(19-16-24-13-12-22(19)28-18-6-2-1-3-7-18)26-15-14-25(17-10-11-17)20-8-4-5-9-21(20)26/h1-9,12-13,16-17H,10-11,14-15H2 |
| InChIKey | XMOWMTQPHWWPJS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone?
The IUPAC name of (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone (CID 71452075) is (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone.
What is the SMILES notation for (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone?
The canonical SMILES for (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone is O=C(c1cnccc1Oc1ccccc1)N1CCN(C2CC2)c2ccccc21.
What is the InChIKey of (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone?
The InChIKey is XMOWMTQPHWWPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O2/c27-23(19-16-24-13-12-22(19)28-18-6-2-1-3-7-18)26-15-14-25(17-10-11-17)20-8-4-5-9-21(20)26/h1-9,12-13,16-17H,10-11,14-15H2.
What are the key properties of (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone?
(4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone has a molecular weight of 371.44 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-2,3-dihydroquinoxalin-1-yl)-(4-phenoxy-3-pyridinyl)methanone is sourced from PubChem (CID 71452075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).