C35H38N6O4 — CID 71452120
(E)-3-[4-[[4-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71452120) has the molecular formula C35H38N6O4 and a molecular weight of 606.73 g/mol. Its IUPAC name is (E)-3-[4-[[4-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71452120 |
| Molecular Formula | C35H38N6O4 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | (E)-3-[4-[[4-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpiperidine-4-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN1CCC(NC(=O)c2ccc3c(C4CCCC4)c(-c4cnccn4)n(C)c3c2)(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C35H38N6O4/c1-40-19-15-35(16-20-40,34(45)38-26-11-7-23(8-12-26)9-14-30(42)43)39-33(44)25-10-13-27-29(21-25)41(2)32(28-22-36-17-18-37-28)31(27)24-5-3-4-6-24/h7-14,17-18,21-22,24H,3-6,15-16,19-20H2,1-2H3,(H,38,45)(H,39,44)(H,42,43)/b14-9+ |
| InChIKey | HSYRGNDZZZIGRY-NTEUORMPSA-N |
| XLogP | 5.22 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|