C34H36N6O4 — CID 71452121
(E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71452121) has the molecular formula C34H36N6O4 and a molecular weight of 592.70 g/mol. Its IUPAC name is (E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71452121 |
| Molecular Formula | C34H36N6O4 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | (E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyrazin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN1CC[C@@](NC(=O)c2ccc3c(C4CCCC4)c(-c4cnccn4)n(C)c3c2)(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)C1 |
| InChI | InChI=1S/C34H36N6O4/c1-39-18-15-34(21-39,33(44)37-25-11-7-22(8-12-25)9-14-29(41)42)38-32(43)24-10-13-26-28(19-24)40(2)31(27-20-35-16-17-36-27)30(26)23-5-3-4-6-23/h7-14,16-17,19-20,23H,3-6,15,18,21H2,1-2H3,(H,37,44)(H,38,43)(H,41,42)/b14-9+/t34-/m0/s1 |
| InChIKey | SXZWAAGEGNJXSI-ATVBPIPYSA-N |
| XLogP | 4.83 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|